C12H11N7OS — CID 135593862
13-ethyl-4-methylsulfanyl-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one (PubChem CID 135593862) has the molecular formula C12H11N7OS and a molecular weight of 301.34 g/mol. Its IUPAC name is 13-ethyl-4-methylsulfanyl-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one.
| Compound Name | 13-ethyl-4-methylsulfanyl-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one |
|---|---|
| PubChem CID | 135593862 |
| Molecular Formula | C12H11N7OS |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 13-ethyl-4-methylsulfanyl-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one |
| SMILES | CCn1ncc2c1ncc1c(=O)[nH]c3nc(SC)nn3c12 |
| InChI | InChI=1S/C12H11N7OS/c1-3-18-9-6(5-14-18)8-7(4-13-9)10(20)15-11-16-12(21-2)17-19(8)11/h4-5H,3H2,1-2H3,(H,15,16,17,20) |
| InChIKey | MFBUZKSJGDSGMB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |