C18H15N4NaO7S2 — CID 135593875
sodium 4-acetamido-5-hydroxy-8-[(4-sulfamoylphenyl)diazenyl]naphthalene-1-sulfonate (PubChem CID 135593875) has the molecular formula C18H15N4NaO7S2 and a molecular weight of 486.46 g/mol. Its IUPAC name is sodium 4-acetamido-5-hydroxy-8-[(4-sulfamoylphenyl)diazenyl]naphthalene-1-sulfonate.
| Compound Name | sodium 4-acetamido-5-hydroxy-8-[(4-sulfamoylphenyl)diazenyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 135593875 |
| Molecular Formula | C18H15N4NaO7S2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | sodium 4-acetamido-5-hydroxy-8-[(4-sulfamoylphenyl)diazenyl]naphthalene-1-sulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)[O-])c2c(/N=N/c3ccc(S(N)(=O)=O)cc3)ccc(O)c12.[Na+] |
| InChI | InChI=1S/C18H16N4O7S2.Na/c1-10(23)20-13-7-9-16(31(27,28)29)18-14(6-8-15(24)17(13)18)22-21-11-2-4-12(5-3-11)30(19,25)26;/h2-9,24H,1H3,(H,20,23)(H2,19,25,26)(H,27,28,29);/q;+1/p-1/b22-21+; |
| InChIKey | MYQNLKLVSGDHNB-QUABFQRHSA-M |
| XLogP | -0.53 |
| TPSA | 191.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|