C20H13N3O6S2 — CID 135597759
methyl 2-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]-2-phenylacetate (PubChem CID 135597759) has the molecular formula C20H13N3O6S2 and a molecular weight of 455.47 g/mol. Its IUPAC name is methyl 2-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 135597759 |
| Molecular Formula | C20H13N3O6S2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | methyl 2-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)n1c(O)c(C2=c3cc([N+](=O)[O-])ccc3=NC2=O)sc1=S |
| InChI | InChI=1S/C20H13N3O6S2/c1-29-19(26)15(10-5-3-2-4-6-10)22-18(25)16(31-20(22)30)14-12-9-11(23(27)28)7-8-13(12)21-17(14)24/h2-9,15,25H,1H3 |
| InChIKey | GTBHJMKYNVTYJW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|