C16H13N3O6S2 — CID 135597795
methyl 4-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoate (PubChem CID 135597795) has the molecular formula C16H13N3O6S2 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl 4-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoate.
| Compound Name | methyl 4-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 135597795 |
| Molecular Formula | C16H13N3O6S2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | methyl 4-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoate |
| SMILES | COC(=O)CCCn1c(O)c(C2=c3cc([N+](=O)[O-])ccc3=NC2=O)sc1=S |
| InChI | InChI=1S/C16H13N3O6S2/c1-25-11(20)3-2-6-18-15(22)13(27-16(18)26)12-9-7-8(19(23)24)4-5-10(9)17-14(12)21/h4-5,7,22H,2-3,6H2,1H3 |
| InChIKey | YDDDWTWMEVAPRS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|