C19H20N2O4S2 — CID 135827423
methyl 6-[4-hydroxy-5-(5-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]hexanoate (PubChem CID 135827423) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl 6-[4-hydroxy-5-(5-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]hexanoate.
| Compound Name | methyl 6-[4-hydroxy-5-(5-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]hexanoate |
|---|---|
| PubChem CID | 135827423 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | methyl 6-[4-hydroxy-5-(5-methyl-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]hexanoate |
| SMILES | COC(=O)CCCCCn1c(O)c(C2=c3cc(C)ccc3=NC2=O)sc1=S |
| InChI | InChI=1S/C19H20N2O4S2/c1-11-7-8-13-12(10-11)15(17(23)20-13)16-18(24)21(19(26)27-16)9-5-3-4-6-14(22)25-2/h7-8,10,24H,3-6,9H2,1-2H3 |
| InChIKey | ZRGGHNZGVKTIMI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|