C14H8Cl2N2O4S2 — CID 176547275
carbon dioxide;5,7-dichloro-3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)indol-2-one (PubChem CID 176547275) has the molecular formula C14H8Cl2N2O4S2 and a molecular weight of 403.27 g/mol. Its IUPAC name is carbon dioxide;5,7-dichloro-3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)indol-2-one.
| Compound Name | carbon dioxide;5,7-dichloro-3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)indol-2-one |
|---|---|
| PubChem CID | 176547275 |
| Molecular Formula | C14H8Cl2N2O4S2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | carbon dioxide;5,7-dichloro-3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)indol-2-one |
| SMILES | CCn1c(O)c(C2=c3cc(Cl)cc(Cl)c3=NC2=O)sc1=S.O=C=O |
| InChI | InChI=1S/C13H8Cl2N2O2S2.CO2/c1-2-17-12(19)10(21-13(17)20)8-6-3-5(14)4-7(15)9(6)16-11(8)18;2-1-3/h3-4,19H,2H2,1H3; |
| InChIKey | LFBQMHKSKSXDJI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|