C14H9FN2O4S2 — CID 176529236
carbon dioxide;3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)-5-fluoroindol-2-one (PubChem CID 176529236) has the molecular formula C14H9FN2O4S2 and a molecular weight of 352.37 g/mol. Its IUPAC name is carbon dioxide;3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)-5-fluoroindol-2-one.
| Compound Name | carbon dioxide;3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)-5-fluoroindol-2-one |
|---|---|
| PubChem CID | 176529236 |
| Molecular Formula | C14H9FN2O4S2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | carbon dioxide;3-(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)-5-fluoroindol-2-one |
| SMILES | CCn1c(O)c(C2=c3cc(F)ccc3=NC2=O)sc1=S.O=C=O |
| InChI | InChI=1S/C13H9FN2O2S2.CO2/c1-2-16-12(18)10(20-13(16)19)9-7-5-6(14)3-4-8(7)15-11(9)17;2-1-3/h3-5,18H,2H2,1H3; |
| InChIKey | VCAGSAPPOLNAJK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|