C27H22N4O4S — CID 3389135
3-[3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-4-hydroxy-1,3-thiazol-5-yl]-5-nitroindol-2-one (PubChem CID 3389135) has the molecular formula C27H22N4O4S and a molecular weight of 498.56 g/mol. Its IUPAC name is 3-[3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-4-hydroxy-1,3-thiazol-5-yl]-5-nitroindol-2-one.
| Compound Name | 3-[3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-4-hydroxy-1,3-thiazol-5-yl]-5-nitroindol-2-one |
|---|---|
| PubChem CID | 3389135 |
| Molecular Formula | C27H22N4O4S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 3-[3-(4-ethylphenyl)-2-(4-ethylphenyl)imino-4-hydroxy-1,3-thiazol-5-yl]-5-nitroindol-2-one |
| SMILES | CCc1ccc(/N=c2\sc(C3=c4cc([N+](=O)[O-])ccc4=NC3=O)c(O)n2-c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C27H22N4O4S/c1-3-16-5-9-18(10-6-16)28-27-30(19-11-7-17(4-2)8-12-19)26(33)24(36-27)23-21-15-20(31(34)35)13-14-22(21)29-25(23)32/h5-15,33H,3-4H2,1-2H3/b28-27- |
| InChIKey | JJEFKRJMCVHBOI-DQSJHHFOSA-N |
| XLogP | 3.87 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|