C18H10N4O5S2 — CID 135582185
N-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide (PubChem CID 135582185) has the molecular formula C18H10N4O5S2 and a molecular weight of 426.44 g/mol. Its IUPAC name is N-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide.
| Compound Name | N-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 135582185 |
| Molecular Formula | C18H10N4O5S2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | N-[4-hydroxy-5-(5-nitro-2-oxoindol-3-yl)-2-sulfanylidene-1,3-thiazol-3-yl]benzamide |
| SMILES | O=C1N=c2ccc([N+](=O)[O-])cc2=C1c1sc(=S)n(NC(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C18H10N4O5S2/c23-15(9-4-2-1-3-5-9)20-21-17(25)14(29-18(21)28)13-11-8-10(22(26)27)6-7-12(11)19-16(13)24/h1-8,25H,(H,20,23) |
| InChIKey | HAIZMASFJUZKAV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|