C18H20ClFN2O2 — CID 135598129
2-[[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]iminomethyl]-4-methoxyphenol (PubChem CID 135598129) has the molecular formula C18H20ClFN2O2 and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]iminomethyl]-4-methoxyphenol.
| Compound Name | 2-[[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]iminomethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135598129 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[[(2S)-2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]iminomethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(/C=N/C[C@H](c2c(F)cccc2Cl)N(C)C)c1 |
| InChI | InChI=1S/C18H20ClFN2O2/c1-22(2)16(18-14(19)5-4-6-15(18)20)11-21-10-12-9-13(24-3)7-8-17(12)23/h4-10,16,23H,11H2,1-3H3/b21-10+/t16-/m1/s1 |
| InChIKey | FJNNFZUQZFBBSA-PPAWOMOGSA-N |
| XLogP | 3.92 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|