C23H26N4O5S — CID 135603356
N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 135603356) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135603356 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(CCCc2nnc(SCC(=O)N/N=C/c3ccc(O)c(OC)c3)o2)cc1C |
| InChI | InChI=1S/C23H26N4O5S/c1-15-11-16(8-10-19(15)30-2)5-4-6-22-26-27-23(32-22)33-14-21(29)25-24-13-17-7-9-18(28)20(12-17)31-3/h7-13,28H,4-6,14H2,1-3H3,(H,25,29)/b24-13+ |
| InChIKey | FIZWIBQQJLGGRU-ZMOGYAJESA-N |
| XLogP | 3.52 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|