C30H29N5O4S — CID 4046923
N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4046923) has the molecular formula C30H29N5O4S and a molecular weight of 555.66 g/mol. Its IUPAC name is N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4046923 |
| Molecular Formula | C30H29N5O4S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-[[5-[3-(4-methoxy-3-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(CCCc2nnc(SCC(=O)NN=Cc3ccc(OCc4ccccc4C#N)cc3)o2)cc1C |
| InChI | InChI=1S/C30H29N5O4S/c1-21-16-22(12-15-27(21)37-2)6-5-9-29-34-35-30(39-29)40-20-28(36)33-32-18-23-10-13-26(14-11-23)38-19-25-8-4-3-7-24(25)17-31/h3-4,7-8,10-16,18H,5-6,9,19-20H2,1-2H3,(H,33,36) |
| InChIKey | UALYAOFKXOCFFC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|