C30H31N5O5S — CID 5228130
2-[4-[[[2-[[5-[3-(4-methoxy-2-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 5228130) has the molecular formula C30H31N5O5S and a molecular weight of 573.68 g/mol. Its IUPAC name is 2-[4-[[[2-[[5-[3-(4-methoxy-2-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[[[2-[[5-[3-(4-methoxy-2-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 5228130 |
| Molecular Formula | C30H31N5O5S |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 2-[4-[[[2-[[5-[3-(4-methoxy-2-methylphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | COc1ccc(CCCc2nnc(SCC(=O)NN=Cc3ccc(OCC(=O)Nc4ccccc4)cc3)o2)c(C)c1 |
| InChI | InChI=1S/C30H31N5O5S/c1-21-17-26(38-2)16-13-23(21)7-6-10-29-34-35-30(40-29)41-20-28(37)33-31-18-22-11-14-25(15-12-22)39-19-27(36)32-24-8-4-3-5-9-24/h3-5,8-9,11-18H,6-7,10,19-20H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | IBKVYYFKWRYDNV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|