C26H30N4O5S — CID 135679399
N-[(E)-(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylideneamino]-2-[[5-[3-(4-methoxyphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 135679399) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylideneamino]-2-[[5-[3-(4-methoxyphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylideneamino]-2-[[5-[3-(4-methoxyphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135679399 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-[(E)-(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylideneamino]-2-[[5-[3-(4-methoxyphenyl)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)CSc2nnc(CCCc3ccc(OC)cc3)o2)cc(OCC)c1O |
| InChI | InChI=1S/C26H30N4O5S/c1-4-7-20-14-19(15-22(25(20)32)34-5-2)16-27-28-23(31)17-36-26-30-29-24(35-26)9-6-8-18-10-12-21(33-3)13-11-18/h4,10-16,32H,1,5-9,17H2,2-3H3,(H,28,31)/b27-16+ |
| InChIKey | OMMIOPAUPZLMRG-JVWAILMASA-N |
| XLogP | 4.33 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|