C29H30N4O4 — CID 4230804
N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-3-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]butanamide (PubChem CID 4230804) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-3-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]butanamide.
| Compound Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-3-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 4230804 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-3-methyl-2-[[2-(2-methylphenoxy)acetyl]amino]butanamide |
| SMILES | Cc1ccccc1OCC(=O)NC(C(=O)NN=Cc1ccc(OCc2ccccc2C#N)cc1)C(C)C |
| InChI | InChI=1S/C29H30N4O4/c1-20(2)28(32-27(34)19-37-26-11-7-4-8-21(26)3)29(35)33-31-17-22-12-14-25(15-13-22)36-18-24-10-6-5-9-23(24)16-30/h4-15,17,20,28H,18-19H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | XZVCKKKUIMZUML-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|