C12H12N4S2 — CID 135603499
11-thia-3,5,6,9-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,4,12(17)-tetraene-8-thione (PubChem CID 135603499) has the molecular formula C12H12N4S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 11-thia-3,5,6,9-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,4,12(17)-tetraene-8-thione.
| Compound Name | 11-thia-3,5,6,9-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,4,12(17)-tetraene-8-thione |
|---|---|
| PubChem CID | 135603499 |
| Molecular Formula | C12H12N4S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 11-thia-3,5,6,9-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,4,12(17)-tetraene-8-thione |
| SMILES | S=C1Cn2ncnc2-c2c(sc3c2CCCC3)N1 |
| InChI | InChI=1S/C12H12N4S2/c17-9-5-16-11(13-6-14-16)10-7-3-1-2-4-8(7)18-12(10)15-9/h6H,1-5H2,(H,15,17) |
| InChIKey | UUJZGNOCSOBFFO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|