C22H26N4O2 — CID 135605299
4-methyl-3-[[4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol (PubChem CID 135605299) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-methyl-3-[[4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol.
| Compound Name | 4-methyl-3-[[4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135605299 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-methyl-3-[[4-(2-morpholin-4-ylethylamino)phenyl]iminomethyl]-1H-indol-2-ol |
| SMILES | Cc1cccc2[nH]c(O)c(/C=N/c3ccc(NCCN4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C22H26N4O2/c1-16-3-2-4-20-21(16)19(22(27)25-20)15-24-18-7-5-17(6-8-18)23-9-10-26-11-13-28-14-12-26/h2-8,15,23,25,27H,9-14H2,1H3/b24-15+ |
| InChIKey | SOUKQXOQNVGXNZ-BUVRLJJBSA-N |
| XLogP | 3.68 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|