C25H25N7O5 — CID 135607705
(Z)-3-hydroxy-3-(4-morpholin-4-yl-3-nitrophenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile (PubChem CID 135607705) has the molecular formula C25H25N7O5 and a molecular weight of 503.52 g/mol. Its IUPAC name is (Z)-3-hydroxy-3-(4-morpholin-4-yl-3-nitrophenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-hydroxy-3-(4-morpholin-4-yl-3-nitrophenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135607705 |
| Molecular Formula | C25H25N7O5 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (Z)-3-hydroxy-3-(4-morpholin-4-yl-3-nitrophenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1nnc(N2CCOCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H25N7O5/c26-17-20(23(33)18-6-7-21(22(16-18)32(34)35)29-8-12-36-13-9-29)24-27-28-25(30-10-14-37-15-11-30)31(24)19-4-2-1-3-5-19/h1-7,16,33H,8-15H2/b23-20- |
| InChIKey | WVEDOYUEPZADSL-ATJXCDBQSA-N |
| XLogP | 2.80 |
| TPSA | 142.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|