C21H16F3N5O — CID 86886508
(Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-3-(3,4,5-trifluorophenyl)prop-2-enenitrile (PubChem CID 86886508) has the molecular formula C21H16F3N5O and a molecular weight of 411.39 g/mol. Its IUPAC name is (Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-3-(3,4,5-trifluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-3-(3,4,5-trifluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 86886508 |
| Molecular Formula | C21H16F3N5O |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-3-(3,4,5-trifluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(F)c(F)c(F)c1)c1nnc(N2CCOCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H16F3N5O/c22-17-11-14(12-18(23)19(17)24)10-15(13-25)20-26-27-21(28-6-8-30-9-7-28)29(20)16-4-2-1-3-5-16/h1-5,10-12H,6-9H2/b15-10- |
| InChIKey | VPIIWXVHZJDAKO-GDNBJRDFSA-N |
| XLogP | 3.59 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|