C24H22N6O — CID 4688071
3-(2-methyl-1H-indol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile (PubChem CID 4688071) has the molecular formula C24H22N6O and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-(2-methyl-1H-indol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile.
| Compound Name | 3-(2-methyl-1H-indol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4688071 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-(2-methyl-1H-indol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C=C(C#N)c1nnc(N2CCOCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H22N6O/c1-17-21(20-9-5-6-10-22(20)26-17)15-18(16-25)23-27-28-24(29-11-13-31-14-12-29)30(23)19-7-3-2-4-8-19/h2-10,15,26H,11-14H2,1H3 |
| InChIKey | DRTRHQVHHXYDNS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|