C23H23N5O3 — CID 6042744
(E)-3-(2,4-dimethoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile (PubChem CID 6042744) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6042744 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)c2nnc(N3CCOCC3)n2-c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H23N5O3/c1-29-20-9-8-17(21(15-20)30-2)14-18(16-24)22-25-26-23(27-10-12-31-13-11-27)28(22)19-6-4-3-5-7-19/h3-9,14-15H,10-13H2,1-2H3/b18-14+ |
| InChIKey | VUJGONBNYSWSDP-NBVRZTHBSA-N |
| XLogP | 3.19 |
| TPSA | 85.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|