C22H20BrN5O2 — CID 74646362
3-(3-bromo-4-methoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile (PubChem CID 74646362) has the molecular formula C22H20BrN5O2 and a molecular weight of 466.34 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 74646362 |
| Molecular Formula | C22H20BrN5O2 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)c2nnc(N3CCOCC3)n2-c2ccccc2)cc1Br |
| InChI | InChI=1S/C22H20BrN5O2/c1-29-20-8-7-16(14-19(20)23)13-17(15-24)21-25-26-22(27-9-11-30-12-10-27)28(21)18-5-3-2-4-6-18/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | GMSVUGMRWDWNMI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|