C22H18N4O4S2 — CID 135608110
4-[(Z)-N-[(E)-[1-(2,4-dihydroxyphenyl)-2-(1,3-thiazol-4-yl)ethylidene]amino]-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol (PubChem CID 135608110) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 4-[(Z)-N-[(E)-[1-(2,4-dihydroxyphenyl)-2-(1,3-thiazol-4-yl)ethylidene]amino]-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[(Z)-N-[(E)-[1-(2,4-dihydroxyphenyl)-2-(1,3-thiazol-4-yl)ethylidene]amino]-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135608110 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 4-[(Z)-N-[(E)-[1-(2,4-dihydroxyphenyl)-2-(1,3-thiazol-4-yl)ethylidene]amino]-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C(Cc2cscn2)=N\N=C(/Cc2cscn2)c2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C22H18N4O4S2/c27-15-1-3-17(21(29)7-15)19(5-13-9-31-11-23-13)25-26-20(6-14-10-32-12-24-14)18-4-2-16(28)8-22(18)30/h1-4,7-12,27-30H,5-6H2/b25-19-,26-20+ |
| InChIKey | FBZPQDVNWJWVPF-GAHATOAQSA-N |
| XLogP | 4.10 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|