C13H14N2O3S — CID 135501970
4-ethyl-6-[(Z)-N-hydroxy-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol (PubChem CID 135501970) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-ethyl-6-[(Z)-N-hydroxy-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-ethyl-6-[(Z)-N-hydroxy-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135501970 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-ethyl-6-[(Z)-N-hydroxy-C-(1,3-thiazol-4-ylmethyl)carbonimidoyl]benzene-1,3-diol |
| SMILES | CCc1cc(/C(Cc2cscn2)=N\O)c(O)cc1O |
| InChI | InChI=1S/C13H14N2O3S/c1-2-8-3-10(13(17)5-12(8)16)11(15-18)4-9-6-19-7-14-9/h3,5-7,16-18H,2,4H2,1H3/b15-11- |
| InChIKey | MWOVTTKGCYDIBN-PTNGSMBKSA-N |
| XLogP | 2.54 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|