C12H16N2O2S — CID 137064112
N-[(Z)-1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]ethanethioamide (PubChem CID 137064112) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-[(Z)-1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]ethanethioamide.
| Compound Name | N-[(Z)-1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]ethanethioamide |
|---|---|
| PubChem CID | 137064112 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-[(Z)-1-(5-ethyl-2,4-dihydroxyphenyl)ethylideneamino]ethanethioamide |
| SMILES | CCc1cc(/C(C)=N\NC(C)=S)c(O)cc1O |
| InChI | InChI=1S/C12H16N2O2S/c1-4-9-5-10(12(16)6-11(9)15)7(2)13-14-8(3)17/h5-6,15-16H,4H2,1-3H3,(H,14,17)/b13-7- |
| InChIKey | QIWNJNJFRMWNHN-QPEQYQDCSA-N |
| XLogP | 2.32 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|