C31H33N5O4 — CID 135622163
1-[2-[4-[[(2-hydroxy-5-nitro-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]ethyl]-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 135622163) has the molecular formula C31H33N5O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is 1-[2-[4-[[(2-hydroxy-5-nitro-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]ethyl]-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[4-[[(2-hydroxy-5-nitro-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]ethyl]-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 135622163 |
| Molecular Formula | C31H33N5O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 1-[2-[4-[[(2-hydroxy-5-nitro-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]ethyl]-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCN(CCc2ccc(/N=C(\c3ccccc3)c3c(O)[nH]c4ccc([N+](=O)[O-])cc34)cc2)CC1 |
| InChI | InChI=1S/C31H33N5O4/c1-34(2)31(38)23-15-18-35(19-16-23)17-14-21-8-10-24(11-9-21)32-29(22-6-4-3-5-7-22)28-26-20-25(36(39)40)12-13-27(26)33-30(28)37/h3-13,20,23,33,37H,14-19H2,1-2H3/b32-29+ |
| InChIKey | OKFFDNAWTIDRHJ-UUDCSCGESA-N |
| XLogP | 5.29 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|