C25H23N5O3 — CID 135815208
3-[C-[4-(aminomethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1H-indol-2-ol (PubChem CID 135815208) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-[C-[4-(aminomethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1H-indol-2-ol.
| Compound Name | 3-[C-[4-(aminomethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1H-indol-2-ol |
|---|---|
| PubChem CID | 135815208 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 3-[C-[4-(aminomethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1H-indol-2-ol |
| SMILES | NCc1ccc(/C(=N\c2ccc3c(c2)CCNC3)c2c(O)[nH]c3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C25H23N5O3/c26-13-15-1-3-16(4-2-15)24(28-19-6-5-18-14-27-10-9-17(18)11-19)23-21-12-20(30(32)33)7-8-22(21)29-25(23)31/h1-8,11-12,27,29,31H,9-10,13-14,26H2/b28-24+ |
| InChIKey | DSVUHYBLGXMJKZ-ZZIIXHQDSA-N |
| XLogP | 4.06 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|