C8H6N2O3 — CID 135624284
5-(2-hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 135624284) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(2-hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 135624284 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 5-(2-hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | O=c1[nH]nc(-c2ccccc2O)o1 |
| InChI | InChI=1S/C8H6N2O3/c11-6-4-2-1-3-5(6)7-9-10-8(12)13-7/h1-4,11H,(H,10,12) |
| InChIKey | GZEMTQWHVDJDBT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |