C19H20F3N3O3 — CID 135629815
(2,4,5-trimethylbenzoyl) 5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 135629815) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is (2,4,5-trimethylbenzoyl) 5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (2,4,5-trimethylbenzoyl) 5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 135629815 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (2,4,5-trimethylbenzoyl) 5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OC(=O)c2cc3n(n2)C(C(F)(F)F)CC(C)N3)cc1C |
| InChI | InChI=1S/C19H20F3N3O3/c1-9-5-11(3)13(6-10(9)2)17(26)28-18(27)14-8-16-23-12(4)7-15(19(20,21)22)25(16)24-14/h5-6,8,12,15,23H,7H2,1-4H3 |
| InChIKey | KHJWUTFDVWLNEL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|