C20H22F3N3O6 — CID 136700915
[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] (5R,7S)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 136700915) has the molecular formula C20H22F3N3O6 and a molecular weight of 457.41 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] (5R,7S)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] (5R,7S)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 136700915 |
| Molecular Formula | C20H22F3N3O6 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] (5R,7S)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COc1cc(C(=O)COC(=O)c2cc3n(n2)[C@H](C(F)(F)F)C[C@@H](C)N3)cc(OC)c1OC |
| InChI | InChI=1S/C20H22F3N3O6/c1-10-5-16(20(21,22)23)26-17(24-10)8-12(25-26)19(28)32-9-13(27)11-6-14(29-2)18(31-4)15(7-11)30-3/h6-8,10,16,24H,5,9H2,1-4H3/t10-,16+/m1/s1 |
| InChIKey | RUTQEWZYTOFGJY-HWPZZCPQSA-N |
| XLogP | 3.26 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |