C17H15F4N3O3 — CID 136836216
[2-(4-fluorophenyl)-2-oxoethyl] (5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 136836216) has the molecular formula C17H15F4N3O3 and a molecular weight of 385.32 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 136836216 |
| Molecular Formula | C17H15F4N3O3 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (5R,7R)-5-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | C[C@@H]1C[C@H](C(F)(F)F)n2nc(C(=O)OCC(=O)c3ccc(F)cc3)cc2N1 |
| InChI | InChI=1S/C17H15F4N3O3/c1-9-6-14(17(19,20)21)24-15(22-9)7-12(23-24)16(26)27-8-13(25)10-2-4-11(18)5-3-10/h2-5,7,9,14,22H,6,8H2,1H3/t9-,14-/m1/s1 |
| InChIKey | HGJLMKYQMPJXOA-YMTOWFKASA-N |
| XLogP | 3.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |