C27H27FN4O2S — CID 135631049
1-[7-(2-fluorophenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 135631049) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is 1-[7-(2-fluorophenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[7-(2-fluorophenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 135631049 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-[7-(2-fluorophenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCN(c2nc3c(-c4ccccc4F)csc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C27H27FN4O2S/c28-22-11-5-4-10-20(22)21-17-35-24-23(21)30-27(31-26(24)34)32-15-12-19(13-16-32)25(33)29-14-6-9-18-7-2-1-3-8-18/h1-5,7-8,10-11,17,19H,6,9,12-16H2,(H,29,33)(H,30,31,34) |
| InChIKey | WNFOGYAUGWDIMU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|