C19H18N6O2 — CID 135631931
6-tert-butyl-8-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one (PubChem CID 135631931) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 6-tert-butyl-8-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one.
| Compound Name | 6-tert-butyl-8-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 135631931 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 6-tert-butyl-8-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
| SMILES | CC(C)(C)c1nn2cnnc2n(/N=C/c2c(O)ccc3ccccc23)c1=O |
| InChI | InChI=1S/C19H18N6O2/c1-19(2,3)16-17(27)25(18-22-20-11-24(18)23-16)21-10-14-13-7-5-4-6-12(13)8-9-15(14)26/h4-11,26H,1-3H3/b21-10+ |
| InChIKey | QWBLXROCZOQNIB-UFFVCSGVSA-N |
| XLogP | 2.32 |
| TPSA | 97.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|