C13H10N4O — CID 136759633
1-[(Z)-1,2,4-triazol-1-yliminomethyl]naphthalen-2-ol (PubChem CID 136759633) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-[(Z)-1,2,4-triazol-1-yliminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(Z)-1,2,4-triazol-1-yliminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136759633 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-[(Z)-1,2,4-triazol-1-yliminomethyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/C=N\n1cncn1 |
| InChI | InChI=1S/C13H10N4O/c18-13-6-5-10-3-1-2-4-11(10)12(13)7-15-17-9-14-8-16-17/h1-9,18H/b15-7- |
| InChIKey | VMGXUDGLVWNQOK-CHHVJCJISA-N |
| XLogP | 2.02 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|