C22H24ClN5O2S3 — CID 135632080
2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide (PubChem CID 135632080) has the molecular formula C22H24ClN5O2S3 and a molecular weight of 522.12 g/mol. Its IUPAC name is 2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 135632080 |
| Molecular Formula | C22H24ClN5O2S3 |
| Molecular Weight | 522.12 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)CSc2nnc(SCc3ccccc3Cl)s2)c(O)c1 |
| InChI | InChI=1S/C22H24ClN5O2S3/c1-3-28(4-2)17-10-9-15(19(29)11-17)12-24-25-20(30)14-32-22-27-26-21(33-22)31-13-16-7-5-6-8-18(16)23/h5-12,29H,3-4,13-14H2,1-2H3,(H,25,30)/b24-12- |
| InChIKey | WCCBHMPFRVWDOM-MSXFZWOLSA-N |
| XLogP | 5.28 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.12 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|