C19H19N5O4 — CID 135634438
2-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 135634438) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135634438 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CC2N=C(N/N=C/c3ccc(O)cc3)NC2=O)c1 |
| InChI | InChI=1S/C19H19N5O4/c1-28-15-4-2-3-13(9-15)21-17(26)10-16-18(27)23-19(22-16)24-20-11-12-5-7-14(25)8-6-12/h2-9,11,16,25H,10H2,1H3,(H,21,26)(H2,22,23,24,27)/b20-11+ |
| InChIKey | RZRLKKIOMPZTHY-RGVLZGJSSA-N |
| XLogP | 1.21 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|