C20H20ClN5O4 — CID 71964703
N-(2-chlorophenyl)-2-[2-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide (PubChem CID 71964703) has the molecular formula C20H20ClN5O4 and a molecular weight of 429.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 71964703 |
| Molecular Formula | C20H20ClN5O4 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-[2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide |
| SMILES | COc1ccc(C=NNC2=NC(CC(=O)Nc3ccccc3Cl)C(=O)N2)cc1OC |
| InChI | InChI=1S/C20H20ClN5O4/c1-29-16-8-7-12(9-17(16)30-2)11-22-26-20-24-15(19(28)25-20)10-18(27)23-14-6-4-3-5-13(14)21/h3-9,11,15H,10H2,1-2H3,(H,23,27)(H2,24,25,26,28) |
| InChIKey | OKDNZGOZHJXRAM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|