C19H17F2N5O4 — CID 135634616
N-[2-(difluoromethoxy)phenyl]-2-[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide (PubChem CID 135634616) has the molecular formula C19H17F2N5O4 and a molecular weight of 417.37 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 135634616 |
| Molecular Formula | C19H17F2N5O4 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-[2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide |
| SMILES | O=C(CC1N=C(N/N=C/c2ccccc2O)NC1=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H17F2N5O4/c20-18(21)30-15-8-4-2-6-12(15)23-16(28)9-13-17(29)25-19(24-13)26-22-10-11-5-1-3-7-14(11)27/h1-8,10,13,18,27H,9H2,(H,23,28)(H2,24,25,26,29)/b22-10+ |
| InChIKey | LJADDZLRYFONOE-LSHDLFTRSA-N |
| XLogP | 1.80 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|