C18H14Cl2FN5O2 — CID 53370231
N-(2,4-dichlorophenyl)-2-[2-[(2E)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide (PubChem CID 53370231) has the molecular formula C18H14Cl2FN5O2 and a molecular weight of 422.25 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[2-[(2E)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[2-[(2E)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 53370231 |
| Molecular Formula | C18H14Cl2FN5O2 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[2-[(2E)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetamide |
| SMILES | O=C(CC1N=C(N/N=C/c2ccc(F)cc2)NC1=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2FN5O2/c19-11-3-6-14(13(20)7-11)23-16(27)8-15-17(28)25-18(24-15)26-22-9-10-1-4-12(21)5-2-10/h1-7,9,15H,8H2,(H,23,27)(H2,24,25,26,28)/b22-9+ |
| InChIKey | ZARTUOKXFSUTKO-LSFURLLWSA-N |
| XLogP | 2.94 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|