C19H16F3N5O2 — CID 53368977
2-[2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 53368977) has the molecular formula C19H16F3N5O2 and a molecular weight of 403.36 g/mol. Its IUPAC name is 2-[2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 53368977 |
| Molecular Formula | C19H16F3N5O2 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-[2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CC1N=C(N/N=C/c2ccccc2)NC1=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N5O2/c20-19(21,22)13-6-8-14(9-7-13)24-16(28)10-15-17(29)26-18(25-15)27-23-11-12-4-2-1-3-5-12/h1-9,11,15H,10H2,(H,24,28)(H2,25,26,27,29)/b23-11+ |
| InChIKey | FFSLSCAMTFUBPC-FOKLQQMPSA-N |
| XLogP | 2.51 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|