C20H19ClN6O3 — CID 71964784
3-[[2-[2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]-N-methylbenzamide (PubChem CID 71964784) has the molecular formula C20H19ClN6O3 and a molecular weight of 426.86 g/mol. Its IUPAC name is 3-[[2-[2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-[2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 71964784 |
| Molecular Formula | C20H19ClN6O3 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 3-[[2-[2-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CC2N=C(NN=Cc3ccccc3Cl)NC2=O)c1 |
| InChI | InChI=1S/C20H19ClN6O3/c1-22-18(29)12-6-4-7-14(9-12)24-17(28)10-16-19(30)26-20(25-16)27-23-11-13-5-2-3-8-15(13)21/h2-9,11,16H,10H2,1H3,(H,22,29)(H,24,28)(H2,25,26,27,30) |
| InChIKey | SRSWMGIQITXEDV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|