C18H16ClN5O2 — CID 52902927
2-[(4S)-2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 52902927) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is 2-[(4S)-2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[(4S)-2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 52902927 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[(4S)-2-[(2E)-2-benzylidenehydrazinyl]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(C[C@@H]1N=C(N/N=C/c2ccccc2)NC1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H16ClN5O2/c19-13-8-4-5-9-14(13)21-16(25)10-15-17(26)23-18(22-15)24-20-11-12-6-2-1-3-7-12/h1-9,11,15H,10H2,(H,21,25)(H2,22,23,24,26)/b20-11+/t15-/m0/s1 |
| InChIKey | RHTFDRMGCUUEOF-BBJIBYMTSA-N |
| XLogP | 2.15 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|