C16H21ClN4O — CID 176988476
2-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-5-one;ethane (PubChem CID 176988476) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-5-one;ethane.
| Compound Name | 2-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-5-one;ethane |
|---|---|
| PubChem CID | 176988476 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-5-one;ethane |
| SMILES | C=C(C)CC1N=C(N/N=C/c2ccc(Cl)cc2)NC1=O.CC |
| InChI | InChI=1S/C14H15ClN4O.C2H6/c1-9(2)7-12-13(20)18-14(17-12)19-16-8-10-3-5-11(15)6-4-10;1-2/h3-6,8,12H,1,7H2,2H3,(H2,17,18,19,20);1-2H3/b16-8+; |
| InChIKey | GRBUOANEXIOIRE-OHGISNTKSA-N |
| XLogP | 3.11 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|