C14H17N5O — CID 176988449
1-[2-[(2E)-2-[(4-aminophenyl)methylidene]hydrazinyl]-5-methylidene-1,4-dihydroimidazol-4-yl]propan-2-one (PubChem CID 176988449) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-[2-[(2E)-2-[(4-aminophenyl)methylidene]hydrazinyl]-5-methylidene-1,4-dihydroimidazol-4-yl]propan-2-one.
| Compound Name | 1-[2-[(2E)-2-[(4-aminophenyl)methylidene]hydrazinyl]-5-methylidene-1,4-dihydroimidazol-4-yl]propan-2-one |
|---|---|
| PubChem CID | 176988449 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[2-[(2E)-2-[(4-aminophenyl)methylidene]hydrazinyl]-5-methylidene-1,4-dihydroimidazol-4-yl]propan-2-one |
| SMILES | C=C1NC(N/N=C/c2ccc(N)cc2)=NC1CC(C)=O |
| InChI | InChI=1S/C14H17N5O/c1-9(20)7-13-10(2)17-14(18-13)19-16-8-11-3-5-12(15)6-4-11/h3-6,8,13H,2,7,15H2,1H3,(H2,17,18,19)/b16-8+ |
| InChIKey | NLKJSZUUSDTAMB-LZYBPNLTSA-N |
| XLogP | 1.01 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|