C16H17N5O — CID 176988493
[4-[(E)-[[5-methylidene-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-2-yl]hydrazinylidene]methyl]phenyl] cyanate (PubChem CID 176988493) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is [4-[(E)-[[5-methylidene-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-2-yl]hydrazinylidene]methyl]phenyl] cyanate.
| Compound Name | [4-[(E)-[[5-methylidene-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-2-yl]hydrazinylidene]methyl]phenyl] cyanate |
|---|---|
| PubChem CID | 176988493 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [4-[(E)-[[5-methylidene-4-(2-methylprop-2-enyl)-1,4-dihydroimidazol-2-yl]hydrazinylidene]methyl]phenyl] cyanate |
| SMILES | C=C(C)CC1N=C(N/N=C/c2ccc(OC#N)cc2)NC1=C |
| InChI | InChI=1S/C16H17N5O/c1-11(2)8-15-12(3)19-16(20-15)21-18-9-13-4-6-14(7-5-13)22-10-17/h4-7,9,15H,1,3,8H2,2H3,(H2,19,20,21)/b18-9+ |
| InChIKey | RJELVJHNJYQLLL-GIJQJNRQSA-N |
| XLogP | 2.28 |
| TPSA | 81.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|