C21H22N6O4 — CID 135641152
N-[4-[(E)-[[6-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl]acetamide (PubChem CID 135641152) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is N-[4-[(E)-[[6-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-[[6-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135641152 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[4-[(E)-[[6-[(3,4-dimethoxyphenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl]acetamide |
| SMILES | COc1ccc(Cc2nnc(N/N=C/c3ccc(NC(C)=O)cc3)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C21H22N6O4/c1-13(28)23-16-7-4-14(5-8-16)12-22-26-21-24-20(29)17(25-27-21)10-15-6-9-18(30-2)19(11-15)31-3/h4-9,11-12H,10H2,1-3H3,(H,23,28)(H2,24,26,27,29)/b22-12+ |
| InChIKey | FVEFKNWAKNVVFH-WSDLNYQXSA-N |
| XLogP | 2.18 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|