C19H18N6O6 — CID 135479822
6-[(3,4-dimethoxyphenyl)methyl]-3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135479822) has the molecular formula C19H18N6O6 and a molecular weight of 426.39 g/mol. Its IUPAC name is 6-[(3,4-dimethoxyphenyl)methyl]-3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(3,4-dimethoxyphenyl)methyl]-3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135479822 |
| Molecular Formula | C19H18N6O6 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 6-[(3,4-dimethoxyphenyl)methyl]-3-[(2E)-2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(Cc2nnc(N/N=C/c3cc([N+](=O)[O-])ccc3O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C19H18N6O6/c1-30-16-6-3-11(8-17(16)31-2)7-14-18(27)21-19(24-22-14)23-20-10-12-9-13(25(28)29)4-5-15(12)26/h3-6,8-10,26H,7H2,1-2H3,(H2,21,23,24,27)/b20-10+ |
| InChIKey | ZSZQEBFFMBNYID-KEBDBYFISA-N |
| XLogP | 1.83 |
| TPSA | 164.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|