C15H16ClN5O4 — CID 135642253
5-tert-butyl-N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide (PubChem CID 135642253) has the molecular formula C15H16ClN5O4 and a molecular weight of 365.78 g/mol. Its IUPAC name is 5-tert-butyl-N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135642253 |
| Molecular Formula | C15H16ClN5O4 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 5-tert-butyl-N-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)N/N=C/c2cc(Cl)cc([N+](=O)[O-])c2O)n[nH]1 |
| InChI | InChI=1S/C15H16ClN5O4/c1-15(2,3)12-6-10(18-19-12)14(23)20-17-7-8-4-9(16)5-11(13(8)22)21(24)25/h4-7,22H,1-3H3,(H,18,19)(H,20,23)/b17-7+ |
| InChIKey | WHUURCMQVZERQS-REZTVBANSA-N |
| XLogP | 2.74 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|