C20H18N4OS — CID 135647975
9-(4-methylphenyl)-8-[(3-methylphenyl)methylsulfanyl]-1H-purin-6-one (PubChem CID 135647975) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 9-(4-methylphenyl)-8-[(3-methylphenyl)methylsulfanyl]-1H-purin-6-one.
| Compound Name | 9-(4-methylphenyl)-8-[(3-methylphenyl)methylsulfanyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135647975 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 9-(4-methylphenyl)-8-[(3-methylphenyl)methylsulfanyl]-1H-purin-6-one |
| SMILES | Cc1ccc(-n2c(SCc3cccc(C)c3)nc3c(=O)[nH]cnc32)cc1 |
| InChI | InChI=1S/C20H18N4OS/c1-13-6-8-16(9-7-13)24-18-17(19(25)22-12-21-18)23-20(24)26-11-15-5-3-4-14(2)10-15/h3-10,12H,11H2,1-2H3,(H,21,22,25) |
| InChIKey | PLJXLEGHOLUORM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |