C17H9Cl2N3O2S — CID 135648709
5-chloro-3-[2-(4-chloroanilino)-4-hydroxy-1,3-thiazol-5-yl]indol-2-one (PubChem CID 135648709) has the molecular formula C17H9Cl2N3O2S and a molecular weight of 390.25 g/mol. Its IUPAC name is 5-chloro-3-[2-(4-chloroanilino)-4-hydroxy-1,3-thiazol-5-yl]indol-2-one.
| Compound Name | 5-chloro-3-[2-(4-chloroanilino)-4-hydroxy-1,3-thiazol-5-yl]indol-2-one |
|---|---|
| PubChem CID | 135648709 |
| Molecular Formula | C17H9Cl2N3O2S |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 5-chloro-3-[2-(4-chloroanilino)-4-hydroxy-1,3-thiazol-5-yl]indol-2-one |
| SMILES | O=C1N=c2ccc(Cl)cc2=C1c1sc(Nc2ccc(Cl)cc2)nc1O |
| InChI | InChI=1S/C17H9Cl2N3O2S/c18-8-1-4-10(5-2-8)20-17-22-16(24)14(25-17)13-11-7-9(19)3-6-12(11)21-15(13)23/h1-7,24H,(H,20,22) |
| InChIKey | SDPATYAQSSSOHU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |